Difference between revisions of "3Z-PHYCOERYTHROBILIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one * smiles: ** c(c2(c(o...")
(Created page with "Category:metabolite == Metabolite 3Z-PHYCOERYTHROBILIN == * common-name: ** (3z)-phycoerythrobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR ==
+
== Metabolite 3Z-PHYCOERYTHROBILIN ==
 
* common-name:
 
* common-name:
** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one
+
** (3z)-phycoerythrobilin
 
* smiles:
 
* smiles:
** c(c2(c(o)c(o)c(nc1(=c(n)c(=o)nc(=n1)n))o2))op(=o)([o-])[o-]
+
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
* inchi-key:
 
* inchi-key:
** oclclrxknjcojd-ummcilcdsa-l
+
** igjxaxffkkrfku-isrbknaysa-l
 
* molecular-weight:
 
* molecular-weight:
** 351.212
+
** 584.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* [[R05819]]
* [[RXN-10057]]
 
* [[RXN-14171]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTP-CYCLOHYDRO-II-RXN]]
+
* [[1.3.7.3-RXN]]
* [[RXN-14171]]
+
* [[R05819]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one}}
+
{{#set: common-name=(3z)-phycoerythrobilin}}
{{#set: inchi-key=inchikey=oclclrxknjcojd-ummcilcdsa-l}}
+
{{#set: inchi-key=inchikey=igjxaxffkkrfku-isrbknaysa-l}}
{{#set: molecular-weight=351.212}}
+
{{#set: molecular-weight=584.671}}

Latest revision as of 11:15, 18 March 2021

Metabolite 3Z-PHYCOERYTHROBILIN

  • common-name:
    • (3z)-phycoerythrobilin
  • smiles:
    • cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
  • inchi-key:
    • igjxaxffkkrfku-isrbknaysa-l
  • molecular-weight:
    • 584.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality