Difference between revisions of "3Z-dodec-3-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9867 == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite 3Z-dodec-3-enoyl-ACPs == * common-name: ** a (3z)-dodec-3-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16615 ==...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9867 ==
+
== Metabolite 3Z-dodec-3-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 3-(all-trans-decaprenyl)benzene-1,2-diol
+
** a (3z)-dodec-3-enoyl-[acp]
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** caujtfnfoamxrt-xrbhbmlssa-n
 
* molecular-weight:
 
** 791.294
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9233]]
+
* [[RXN-16615]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=a (3z)-dodec-3-enoyl-[acp]}}
{{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}}
 
{{#set: molecular-weight=791.294}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 3Z-dodec-3-enoyl-ACPs

  • common-name:
    • a (3z)-dodec-3-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3z)-dodec-3-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.