Difference between revisions of "3b-hydroxy-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine == * common-name: ** a [hect-type e3 ubiquitin transferase]-s-ubiquitinyl-l-cysteine == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CAFFEOYL-COA == * common-name: ** trans-caffeoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ubiquitinyl-HECT-E3-UCP-L-cysteine ==
+
== Metabolite CAFFEOYL-COA ==
 
* common-name:
 
* common-name:
** a [hect-type e3 ubiquitin transferase]-s-ubiquitinyl-l-cysteine
+
** trans-caffeoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** qhrgjmimhclhrg-zseliehesa-j
 +
* molecular-weight:
 +
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15560]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15559]]
+
* [[RXN-1126]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [hect-type e3 ubiquitin transferase]-s-ubiquitinyl-l-cysteine}}
+
{{#set: common-name=trans-caffeoyl-coa}}
 +
{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
 +
{{#set: molecular-weight=925.647}}

Revision as of 08:31, 15 March 2021

Metabolite CAFFEOYL-COA

  • common-name:
    • trans-caffeoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • qhrgjmimhclhrg-zseliehesa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality