Difference between revisions of "3b-hydroxy-D5-steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17539 == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** jagleobxishnnm-br...")
(Created page with "Category:metabolite == Metabolite 3b-hydroxy-D5-steroids == * common-name: ** a 3β-hydroxy-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1....")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17539 ==
+
== Metabolite 3b-hydroxy-D5-steroids ==
 
* common-name:
 
* common-name:
** dapdiamide a
+
** a 3β-hydroxy-δ5-steroid
* smiles:
 
** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
 
* inchi-key:
 
** jagleobxishnnm-bruqvklwsa-n
 
* molecular-weight:
 
** 300.314
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.145-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16291]]
+
* [[1.1.1.145-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dapdiamide a}}
+
{{#set: common-name=a 3β-hydroxy-δ5-steroid}}
{{#set: inchi-key=inchikey=jagleobxishnnm-bruqvklwsa-n}}
 
{{#set: molecular-weight=300.314}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 3b-hydroxy-D5-steroids

  • common-name:
    • a 3β-hydroxy-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality