Difference between revisions of "3b-hydroxy-D5-steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17539 == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** jagleobxishnnm-br...") |
(Created page with "Category:metabolite == Metabolite SUPER-OXIDE == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouuqczgpvncoij-uhfffaoysa-m * molecular-weight: ** 31.999...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SUPER-OXIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** superoxide |
* smiles: | * smiles: | ||
| − | ** | + | ** [o-]o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ouuqczgpvncoij-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 31.999 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SUPEROX-DISMUT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12615]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=superoxide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ouuqczgpvncoij-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=31.999}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite SUPER-OXIDE
- common-name:
- superoxide
- smiles:
- [o-]o
- inchi-key:
- ouuqczgpvncoij-uhfffaoysa-m
- molecular-weight:
- 31.999
