Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14171 RXN-14171] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.1...")
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * inch...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14171 RXN-14171] ==
+
== Metabolite 4-AMINO-4-DEOXYCHORISMATE ==
−
* direction:
+
* common-name:
−
** reversible
+
** 4-amino-4-deoxychorismate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.302 ec-1.1.1.302]
+
** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-10809]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
+
** oiujhgolfkdbsu-htqzyqbosa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02182]]
+
** 224.193
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ADCLY-RXN]]
−
== Pathway(s) ==
+
* [[PABASYN-RXN]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADCLY-RXN]]
−
== External links  ==
+
* [[PABASYN-RXN]]
−
* LIGAND-RXN:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.genome.jp/dbget-bin/www_bget?R09376 R09376]
+
{{#set: common-name=4-amino-4-deoxychorismate}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=oiujhgolfkdbsu-htqzyqbosa-m}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27281 27281]
+
{{#set: molecular-weight=224.193}}
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-1.1.1.302}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 4-AMINO-4-DEOXYCHORISMATE

  • common-name:
    • 4-amino-4-deoxychorismate
  • smiles:
    • c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
  • inchi-key:
    • oiujhgolfkdbsu-htqzyqbosa-m
  • molecular-weight:
    • 224.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-AMINO-4-DEOXYCHORISMATE&oldid=139580"