Difference between revisions of "4-AMINO-BUTYRALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2190 == * common-name: ** 1-18:3-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite CPD-7036 == * common-name: ** 3-methylthiopropanal * smiles: ** csccc=o * inchi-key: ** cluwowrthnnbbu-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2190 ==
+
== Metabolite CPD-7036 ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:3-monogalactosyldiacylglycerol
+
** 3-methylthiopropanal
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
+
** csccc=o
 
* inchi-key:
 
* inchi-key:
** zrlaoeyzskxgsl-rzrnqmrlsa-n
+
** cluwowrthnnbbu-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 747.02
+
** 104.167
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7706]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8301]]
 
* [[RXN-8309]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:3-monogalactosyldiacylglycerol}}
+
{{#set: common-name=3-methylthiopropanal}}
{{#set: inchi-key=inchikey=zrlaoeyzskxgsl-rzrnqmrlsa-n}}
+
{{#set: inchi-key=inchikey=cluwowrthnnbbu-uhfffaoysa-n}}
{{#set: molecular-weight=747.02}}
+
{{#set: molecular-weight=104.167}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-7036

  • common-name:
    • 3-methylthiopropanal
  • smiles:
    • csccc=o
  • inchi-key:
    • cluwowrthnnbbu-uhfffaoysa-n
  • molecular-weight:
    • 104.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality