Difference between revisions of "4-AMINO-BUTYRALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7036 == * common-name: ** 3-methylthiopropanal * smiles: ** csccc=o * inchi-key: ** cluwowrthnnbbu-uhfffaoysa-n * molecular-weight: *...")
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7036 ==
+
== Metabolite CPD-19150 ==
 
* common-name:
 
* common-name:
** 3-methylthiopropanal
+
** (2e,5z)-dodecenoyl-coa
 
* smiles:
 
* smiles:
** csccc=o
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** cluwowrthnnbbu-uhfffaoysa-n
+
** zsjrxhrcabosnc-shjpognxsa-j
 
* molecular-weight:
 
* molecular-weight:
** 104.167
+
** 941.776
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7706]]
+
* [[RXN-17797]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17796]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylthiopropanal}}
+
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
{{#set: inchi-key=inchikey=cluwowrthnnbbu-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}
{{#set: molecular-weight=104.167}}
+
{{#set: molecular-weight=941.776}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-19150

  • common-name:
    • (2e,5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-shjpognxsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality