Difference between revisions of "4-AMINO-BUTYRALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * smiles: ** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o) * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l...") |
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRALDEHYDE == * common-name: ** 4-aminobutanal * smiles: ** c(c[n+])cc=o * inchi-key: ** dzqlqeyleywjib-uhfffaoysa-o * molecul...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-AMINO-BUTYRALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-aminobutanal |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c[n+])cc=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dzqlqeyleywjib-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 88.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14209]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14209]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-aminobutanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dzqlqeyleywjib-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=88.129}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 4-AMINO-BUTYRALDEHYDE
- common-name:
- 4-aminobutanal
- smiles:
- c(c[n+])cc=o
- inchi-key:
- dzqlqeyleywjib-uhfffaoysa-o
- molecular-weight:
- 88.129
