Difference between revisions of "4-AMINO-BUTYRALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8314 RXN-8314] == * direction: ** left-to-right * common-name: ** 1-18:2-2-18:3-digalactosyldia...")
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * smiles: ** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o) * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8314 RXN-8314] ==
+
== Metabolite QUINOLINATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1-18:2-2-18:3-digalactosyldiacylglycerol desaturase
+
** quinolinate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.35 ec-1.14.19.35]
+
** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8083]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[CPD-8081]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] '''+''' 2 [[WATER]][c]
+
** gjawhxhkyyxbsv-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03069]]
+
** 165.105
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[QUINOPRIBOTRANS-RXN]]
−
* Gene: [[SJ09228]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[QUINOLINATE-SYNTHA-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-782]], glycolipid desaturation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-782 PWY-782]
+
{{#set: common-name=quinolinate}}
−
** '''16''' reactions found over '''28''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=gjawhxhkyyxbsv-uhfffaoysa-l}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=165.105}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.35}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite QUINOLINATE

  • common-name:
    • quinolinate
  • smiles:
    • c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o)
  • inchi-key:
    • gjawhxhkyyxbsv-uhfffaoysa-l
  • molecular-weight:
    • 165.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-AMINO-BUTYRALDEHYDE&oldid=47345"