Difference between revisions of "4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N3-METHYLCYTOSINE == * common-name: ** n3-methylcytosine * smiles: ** c[n+]1(c(nc=cc(n)=1)=o) * inchi-key: ** uphqqdzirihphu-uhfffaoysa-o...")
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N3-METHYLCYTOSINE ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
 
* common-name:
 
* common-name:
** n3-methylcytosine
+
** cis-dienelactone
 
* smiles:
 
* smiles:
** c[n+]1(c(nc=cc(n)=1)=o)
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 
* inchi-key:
 
* inchi-key:
** uphqqdzirihphu-uhfffaoysa-o
+
** ayfxpgxazmfwnh-arjawskdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 126.138
+
** 139.087
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-985]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n3-methylcytosine}}
+
{{#set: common-name=cis-dienelactone}}
{{#set: inchi-key=inchikey=uphqqdzirihphu-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
{{#set: molecular-weight=126.138}}
+
{{#set: molecular-weight=139.087}}

Latest revision as of 11:13, 18 March 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality