Difference between revisions of "4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine == * common-name: ** an n-terminal l-cysteinyl-[protein] == Reaction(s) known to consume the compound == == Reactio...")
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-L-cysteine ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
 
* common-name:
 
* common-name:
** an n-terminal l-cysteinyl-[protein]
+
** cis-dienelactone
 +
* smiles:
 +
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 +
* inchi-key:
 +
** ayfxpgxazmfwnh-arjawskdsa-m
 +
* molecular-weight:
 +
** 139.087
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17874]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal l-cysteinyl-[protein]}}
+
{{#set: common-name=cis-dienelactone}}
 +
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
 +
{{#set: molecular-weight=139.087}}

Latest revision as of 11:13, 18 March 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality