Difference between revisions of "4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01107 == * transcription-direction: ** positive * right-end-position: ** 346441 * left-end-position: ** 309458 * centisome-position: ** 27.930706...")
 
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01107 ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
* transcription-direction:
+
* common-name:
** positive
+
** cis-dienelactone
* right-end-position:
+
* smiles:
** 346441
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
* left-end-position:
+
* inchi-key:
** 309458
+
** ayfxpgxazmfwnh-arjawskdsa-m
* centisome-position:
+
* molecular-weight:
** 27.930706   
+
** 139.087
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[FADSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=cis-dienelactone}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
** Category: [[orthology]]
+
{{#set: molecular-weight=139.087}}
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY66-366]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[RIBOSYN2-PWY]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6167]]
 
** '''5''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-6168]]
 
** '''7''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=346441}}
 
{{#set: left-end-position=309458}}
 
{{#set: centisome-position=27.930706    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality