Difference between revisions of "4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17818 == * transcription-direction: ** positive * right-end-position: ** 131587 * left-end-position: ** 123060 * centisome-position: ** 48.249363...")
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17818 ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** cis-dienelactone
−
* right-end-position:
+
* smiles:
−
** 131587
+
** c1(=cc(=o)oc(=cc(=o)[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 123060
+
** ayfxpgxazmfwnh-arjawskdsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 48.249363   
+
** 139.087
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.10.1-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=cis-dienelactone}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
−
* [[2.7.11.25-RXN]]
+
{{#set: molecular-weight=139.087}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[2.7.12.1-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14906]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8443]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5381]]
 
−
** '''6''' reactions found over '''11''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=131587}}
 
−
{{#set: left-end-position=123060}}
 
−
{{#set: centisome-position=48.249363    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE&oldid=137900"