Difference between revisions of "4-CYTIDINE-5-DIPHOSPHO-2-C"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10244 == * transcription-direction: ** positive * right-end-position: ** 62596 * left-end-position: ** 33464 * centisome-position: ** 8.487284...")
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc(o)(co)c(o)cop(op([o-])(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10244 ==
+
== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
−
* right-end-position:
+
* smiles:
−
** 62596
+
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 33464
+
** yfaukwznpvbcff-xhibxcghsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 8.487284   
+
** 519.295
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.1.148-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[3.4.11.2-RXN]]
+
* [[2.7.7.60-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=519.295}}
−
* [[RXN-13677]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-6642]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7112]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6842]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4061]]
 
−
** '''4''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=62596}}
 
−
{{#set: left-end-position=33464}}
 
−
{{#set: centisome-position=8.487284    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C

  • common-name:
    • 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • smiles:
    • cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
  • inchi-key:
    • yfaukwznpvbcff-xhibxcghsa-l
  • molecular-weight:
    • 519.295

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-CYTIDINE-5-DIPHOSPHO-2-C&oldid=137930"