Difference between revisions of "4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13684 == * common-name: ** cholest-5-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inc...")
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13684 ==
+
== Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S ==
 
* common-name:
 
* common-name:
** cholest-5-en-3-one
+
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 
* inchi-key:
 
* inchi-key:
** ggclnoigpmgldb-gykmgiidsa-n
+
** bujztfindcqrgp-ztvljyeesa-l
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 457.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12693]]
+
* [[RXN-12177]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12693]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholest-5-en-3-one}}
+
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
{{#set: inchi-key=inchikey=ggclnoigpmgldb-gykmgiidsa-n}}
+
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=457.362}}

Latest revision as of 11:14, 18 March 2021

Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S

  • common-name:
    • 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
  • smiles:
    • cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • bujztfindcqrgp-ztvljyeesa-l
  • molecular-weight:
    • 457.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality