Difference between revisions of "4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-pi-phospho-L-histidines == * common-name: ** a [protein]-nπ-phospho-l-histidine == Reaction(s) known to consume the compound =...")
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite Protein-pi-phospho-L-histidines ==
+
== Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S ==
 
* common-name:
 
* common-name:
−
** a [protein]-nπ-phospho-l-histidine
+
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
 +
* smiles:
 +
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 +
* inchi-key:
 +
** bujztfindcqrgp-ztvljyeesa-l
 +
* molecular-weight:
 +
** 457.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-15509]]
+
* [[RXN-12177]]
−
* [[RXN-15510]]
 
−
* [[RXN-15511]]
 
−
* [[RXN-15512]]
 
−
* [[RXN-17131]]
 
−
* [[RXN-17276]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15509]]
 
−
* [[RXN-15510]]
 
−
* [[RXN-15511]]
 
−
* [[RXN-15512]]
 
−
* [[RXN-17274]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=a [protein]-nπ-phospho-l-histidine}}
+
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
 +
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
 +
{{#set: molecular-weight=457.362}}

Latest revision as of 11:14, 18 March 2021

Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S

  • common-name:
    • 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
  • smiles:
    • cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • bujztfindcqrgp-ztvljyeesa-l
  • molecular-weight:
    • 457.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S&oldid=138023"