Difference between revisions of "4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16278 == * transcription-direction: ** negative * right-end-position: ** 5696 * left-end-position: ** 34 * centisome-position: ** 0.59223133 ==...") |
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == |
− | * | + | * common-name: |
− | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate |
− | + | * smiles: | |
− | + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) | |
− | + | * inchi-key: | |
− | + | ** bujztfindcqrgp-ztvljyeesa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 457.362 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12177]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}} | |
− | ** | + | {{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}} |
− | * | + | {{#set: molecular-weight=457.362}} |
− | |||
− | ** | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
- smiles:
- cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- bujztfindcqrgp-ztvljyeesa-l
- molecular-weight:
- 457.362