Difference between revisions of "4-GUANIDO-BUTYRAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1163 == * common-name: ** (s)-3-hydroxy-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite 4-GUANIDO-BUTYRAMIDE == * common-name: ** 4-guanidinobutyramide * smiles: ** c(nc(n)=[n+])ccc(=o)n * inchi-key: ** yhvfecvvgnxfko-uhfffao...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1163 ==
+
== Metabolite 4-GUANIDO-BUTYRAMIDE ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(5z)-tetradecenoyl-coa
+
** 4-guanidinobutyramide
 
* smiles:
 
* smiles:
** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(nc(n)=[n+])ccc(=o)n
 
* inchi-key:
 
* inchi-key:
** kjjpuifalmaqpf-suakzgbesa-j
+
** yhvfecvvgnxfko-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 987.845
+
** 145.184
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14393]]
+
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14393]]
 
* [[RXN0-5393]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=4-guanidinobutyramide}}
{{#set: inchi-key=inchikey=kjjpuifalmaqpf-suakzgbesa-j}}
+
{{#set: inchi-key=inchikey=yhvfecvvgnxfko-uhfffaoysa-o}}
{{#set: molecular-weight=987.845}}
+
{{#set: molecular-weight=145.184}}

Latest revision as of 11:13, 18 March 2021

Metabolite 4-GUANIDO-BUTYRAMIDE

  • common-name:
    • 4-guanidinobutyramide
  • smiles:
    • c(nc(n)=[n+])ccc(=o)n
  • inchi-key:
    • yhvfecvvgnxfko-uhfffaoysa-o
  • molecular-weight:
    • 145.184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality