Difference between revisions of "4-GUANIDO-BUTYRAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...") |
(Created page with "Category:metabolite == Metabolite 4-GUANIDO-BUTYRAMIDE == * common-name: ** 4-guanidinobutyramide * smiles: ** c(nc(n)=[n+])ccc(=o)n * inchi-key: ** yhvfecvvgnxfko-uhfffao...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-GUANIDO-BUTYRAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-guanidinobutyramide |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(nc(n)=[n+])ccc(=o)n |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yhvfecvvgnxfko-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 145.184 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-guanidinobutyramide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhvfecvvgnxfko-uhfffaoysa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.184}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 4-GUANIDO-BUTYRAMIDE
- common-name:
- 4-guanidinobutyramide
- smiles:
- c(nc(n)=[n+])ccc(=o)n
- inchi-key:
- yhvfecvvgnxfko-uhfffaoysa-o
- molecular-weight:
- 145.184