Difference between revisions of "4-HYDROXY-L-PROLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRYPTOPHAN-AMINOTRANSFERASE-RXN TRYPTOPHAN-AMINOTRANSFERASE-RXN] == * direction: ** reversible * co...")
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRYPTOPHAN-AMINOTRANSFERASE-RXN TRYPTOPHAN-AMINOTRANSFERASE-RXN] ==
+
== Metabolite 4-HYDROXY-L-PROLINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** l-tryptophan:2-oxoglutarate aminotransferase
+
** trans-4-hydroxy-l-proline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.6.1.27 ec-2.6.1.27]
+
** c1([n+]c(c(=o)[o-])cc(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[TRP]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[INDOLE_PYRUVATE]][c]
+
** pmmyeevymwasqn-dmtcnviqsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04188]]
+
** 131.131
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN490-3641]]
−
* [[PWY-5081]], L-tryptophan degradation VIII (to tryptophol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5081 PWY-5081]
+
* [[RXN66-546]]
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[TRPKYNCAT-PWY]], L-tryptophan degradation IV (via indole-3-lactate): [http://metacyc.org/META/NEW-IMAGE?object=TRPKYNCAT-PWY TRPKYNCAT-PWY]
+
{{#set: common-name=trans-4-hydroxy-l-proline}}
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}}
−
* [[TRPIAACAT-PWY]], indole-3-acetate biosynthesis VI (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=TRPIAACAT-PWY TRPIAACAT-PWY]
+
{{#set: molecular-weight=131.131}}
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
 
−
** '''5''' reactions found over '''12''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14096 14096]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00684 R00684]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=l-tryptophan:2-oxoglutarate aminotransferase}}
 
−
{{#set: ec-number=ec-2.6.1.27}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 4-HYDROXY-L-PROLINE

  • common-name:
    • trans-4-hydroxy-l-proline
  • smiles:
    • c1([n+]c(c(=o)[o-])cc(o)1)
  • inchi-key:
    • pmmyeevymwasqn-dmtcnviqsa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-HYDROXY-L-PROLINE&oldid=138828"