Difference between revisions of "4-HYDROXY-L-PROLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 10-FORMYL-DIHYDROFOLATE-GLU-N == * common-name: ** an n10-formyldihydrofolate == Reaction(s) known to consume the compound == == Reaction...")
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 10-FORMYL-DIHYDROFOLATE-GLU-N ==
+
== Metabolite 4-HYDROXY-L-PROLINE ==
 
* common-name:
 
* common-name:
** an n10-formyldihydrofolate
+
** trans-4-hydroxy-l-proline
 +
* smiles:
 +
** c1([n+]c(c(=o)[o-])cc(o)1)
 +
* inchi-key:
 +
** pmmyeevymwasqn-dmtcnviqsa-n
 +
* molecular-weight:
 +
** 131.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13908]]
+
* [[RXN490-3641]]
 +
* [[RXN66-546]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n10-formyldihydrofolate}}
+
{{#set: common-name=trans-4-hydroxy-l-proline}}
 +
{{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}}
 +
{{#set: molecular-weight=131.131}}

Latest revision as of 11:15, 18 March 2021

Metabolite 4-HYDROXY-L-PROLINE

  • common-name:
    • trans-4-hydroxy-l-proline
  • smiles:
    • c1([n+]c(c(=o)[o-])cc(o)1)
  • inchi-key:
    • pmmyeevymwasqn-dmtcnviqsa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality