Difference between revisions of "4-HYDROXY-L-PROLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9634 RXN-9634] == * direction: ** left-to-right * common-name: ** 3-hydroxystearoyl-[acyl-carri...")
 
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9634 RXN-9634] ==
+
== Metabolite 4-HYDROXY-L-PROLINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-hydroxystearoyl-[acyl-carrier protein] dehydratase
+
** trans-4-hydroxy-l-proline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
+
** c1([n+]c(c(=o)[o-])cc(o)1)
−
** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59]
+
* inchi-key:
−
== Reaction formula ==
+
** pmmyeevymwasqn-dmtcnviqsa-n
−
* 1 [[R-3-hydroxystearoyl-ACPs]][c] '''=>''' 1 [[Octadec-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 131.131
−
* Gene: [[SJ10275]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN490-3641]]
−
== Pathway(s) ==
+
* [[RXN66-546]]
−
* [[PWY3O-355]], stearate biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: common-name=trans-4-hydroxy-l-proline}}
−
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
+
{{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}}
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: molecular-weight=131.131}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-hydroxystearoyl-[acyl-carrier protein] dehydratase}}
 
−
{{#set: ec-number=ec-4.2.1.59|ec-2.3.1.86}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 4-HYDROXY-L-PROLINE

  • common-name:
    • trans-4-hydroxy-l-proline
  • smiles:
    • c1([n+]c(c(=o)[o-])cc(o)1)
  • inchi-key:
    • pmmyeevymwasqn-dmtcnviqsa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-HYDROXY-L-PROLINE&oldid=138828"