Difference between revisions of "4-HYDROXY-L-PROLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4162 == * common-name: ** stigmasterol * smiles: ** ccc(c(c)c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) * inchi-...") |
(Created page with "Category:metabolite == Metabolite 4-HYDROXY-L-PROLINE == * common-name: ** trans-4-hydroxy-l-proline * smiles: ** c1([n+]c(c(=o)[o-])cc(o)1) * inchi-key: ** pmmyeevymwasqn...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-HYDROXY-L-PROLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-4-hydroxy-l-proline |
* smiles: | * smiles: | ||
| − | ** | + | ** c1([n+]c(c(=o)[o-])cc(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pmmyeevymwasqn-dmtcnviqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN490-3641]] | ||
| + | * [[RXN66-546]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-4-hydroxy-l-proline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.131}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 4-HYDROXY-L-PROLINE
- common-name:
- trans-4-hydroxy-l-proline
- smiles:
- c1([n+]c(c(=o)[o-])cc(o)1)
- inchi-key:
- pmmyeevymwasqn-dmtcnviqsa-n
- molecular-weight:
- 131.131
