Difference between revisions of "4-HYDROXYBENZALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
(Created page with "Category:metabolite == Metabolite 4-HYDROXYBENZALDEHYDE == * common-name: ** 4-hydroxybenzaldehyde * smiles: ** [ch](c1(c=cc(o)=cc=1))=o * inchi-key: ** rghhsnmvtdwubi-uhf...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-HYDROXYBENZALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxybenzaldehyde |
* smiles: | * smiles: | ||
− | ** c1(c( | + | ** [ch](c1(c=cc(o)=cc=1))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rghhsnmvtdwubi-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 122.123 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-8872]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13600]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghhsnmvtdwubi-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=122.123}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 4-HYDROXYBENZALDEHYDE
- common-name:
- 4-hydroxybenzaldehyde
- smiles:
- [ch](c1(c=cc(o)=cc=1))=o
- inchi-key:
- rghhsnmvtdwubi-uhfffaoysa-n
- molecular-weight:
- 122.123