Difference between revisions of "4-METHYL-824-CHOLESTADIENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11410 == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([...")
(Created page with "Category:metabolite == Metabolite 4-METHYL-824-CHOLESTADIENOL == * common-name: ** 4α-methyl-zymosterol * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)cc...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11410 ==
+
== Metabolite 4-METHYL-824-CHOLESTADIENOL ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ether glucuronide
+
** 4α-methyl-zymosterol
 
* smiles:
 
* smiles:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
+
** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** vxvbzmwowmhxtq-kfyubchvsa-l
+
** foujwbxbkvvhcj-yijygbtnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 796.046
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13709]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 +
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10619]]
+
* [[RXN-11878]]
 +
* [[RXN66-314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ether glucuronide}}
+
{{#set: common-name=4α-methyl-zymosterol}}
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
+
{{#set: inchi-key=inchikey=foujwbxbkvvhcj-yijygbtnsa-n}}
{{#set: molecular-weight=796.046}}
+
{{#set: molecular-weight=398.671}}

Latest revision as of 11:15, 18 March 2021

Metabolite 4-METHYL-824-CHOLESTADIENOL

  • common-name:
    • 4α-methyl-zymosterol
  • smiles:
    • cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c)c(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • foujwbxbkvvhcj-yijygbtnsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality