Difference between revisions of "4-METHYL-824-CHOLESTADIENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
(Created page with "Category:metabolite == Metabolite Beta-D-glucosides == * common-name: ** a β-d glucoside == Reaction(s) known to consume the compound == * 3.2.1.21-RXN == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-D-glucosides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-d glucoside |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.2.1.21-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-d glucoside}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite Beta-D-glucosides
- common-name:
- a β-d glucoside
