Difference between revisions of "4-METHYL-MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-TRP-tRNAs == * common-name: ** an l-tryptophanyl-[trnatrp] == Reaction(s) known to consume the compound == == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-TRP-tRNAs ==
+
== Metabolite 4-METHYL-MYO-INOSITOL ==
 
* common-name:
 
* common-name:
** an l-tryptophanyl-[trnatrp]
+
** d-ononitol
 +
* smiles:
 +
** coc1(c(o)c(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** dscffeyyqksrsv-geskjzqwsa-n
 +
* molecular-weight:
 +
** 194.184
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8281]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-tryptophanyl-[trnatrp]}}
+
{{#set: common-name=d-ononitol}}
 +
{{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}}
 +
{{#set: molecular-weight=194.184}}

Latest revision as of 11:12, 18 March 2021

Metabolite 4-METHYL-MYO-INOSITOL

  • common-name:
    • d-ononitol
  • smiles:
    • coc1(c(o)c(o)c(o)c(o)c(o)1)
  • inchi-key:
    • dscffeyyqksrsv-geskjzqwsa-n
  • molecular-weight:
    • 194.184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality