Difference between revisions of "4-METHYL-MYO-INOSITOL"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19026 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.22.15-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 4-METHYL-MYO-INOSITOL == |
| − | == | + | * common-name: |
| − | * [[ | + | ** d-ononitol |
| − | == Reaction(s) | + | * smiles: |
| − | + | ** coc1(c(o)c(o)c(o)c(o)c(o)1) | |
| − | + | * inchi-key: | |
| − | + | ** dscffeyyqksrsv-geskjzqwsa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 194.184 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8281]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=d-ononitol}} | ||
| + | {{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}} | ||
| + | {{#set: molecular-weight=194.184}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 4-METHYL-MYO-INOSITOL
- common-name:
- d-ononitol
- smiles:
- coc1(c(o)c(o)c(o)c(o)c(o)1)
- inchi-key:
- dscffeyyqksrsv-geskjzqwsa-n
- molecular-weight:
- 194.184
