Difference between revisions of "4-METHYL-MYO-INOSITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22166 == * transcription-direction: ** negative * right-end-position: ** 468963 * left-end-position: ** 455190 * centisome-position: ** 78.015495...")
 
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ22166 ==
+
== Metabolite 4-METHYL-MYO-INOSITOL ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** d-ononitol
−
* right-end-position:
+
* smiles:
−
** 468963
+
** coc1(c(o)c(o)c(o)c(o)c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 455190
+
** dscffeyyqksrsv-geskjzqwsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 78.015495   
+
** 194.184
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8281]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=d-ononitol}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=194.184}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ENOYL-COA-DELTA-ISOM-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[HICH]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13721]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-6384]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[VALDEG-PWY]]
 
−
** '''6''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5137]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[FAO-PWY]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-3941]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7574]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=468963}}
 
−
{{#set: left-end-position=455190}}
 
−
{{#set: centisome-position=78.015495    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 4-METHYL-MYO-INOSITOL

  • common-name:
    • d-ononitol
  • smiles:
    • coc1(c(o)c(o)c(o)c(o)c(o)1)
  • inchi-key:
    • dscffeyyqksrsv-geskjzqwsa-n
  • molecular-weight:
    • 194.184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-METHYL-MYO-INOSITOL&oldid=137457"