Difference between revisions of "4-METHYL-MYO-INOSITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite 4-METHYL-MYO-INOSITOL == * common-name: ** d-ononitol * smiles: ** coc1(c(o)c(o)c(o)c(o)c(o)1) * inchi-key: ** dscffeyyqksrsv-geskjzqwsa-...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-METHYL-MYO-INOSITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-ononitol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(c(o)c(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dscffeyyqksrsv-geskjzqwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 194.184 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-ononitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dscffeyyqksrsv-geskjzqwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=194.184}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 4-METHYL-MYO-INOSITOL
- common-name:
- d-ononitol
- smiles:
- coc1(c(o)c(o)c(o)c(o)c(o)1)
- inchi-key:
- dscffeyyqksrsv-geskjzqwsa-n
- molecular-weight:
- 194.184
