Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8613 == * common-name: ** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c...")
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8613 ==
+
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
 
* common-name:
 
* common-name:
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)(c([o-])=o)c(o)cc3)))cc4)))c
+
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** glcdbdrqlzkkoj-ljaizbfvsa-m
+
** rqmcndrmpzbeod-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 443.688
+
** 217.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-18]]
+
* [[RXN-2464]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-2464]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
{{#set: inchi-key=inchikey=glcdbdrqlzkkoj-ljaizbfvsa-m}}
+
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
{{#set: molecular-weight=443.688}}
+
{{#set: molecular-weight=217.112}}

Latest revision as of 11:16, 18 March 2021

Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE

  • common-name:
    • 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
  • smiles:
    • c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
  • inchi-key:
    • rqmcndrmpzbeod-uhfffaoysa-k
  • molecular-weight:
    • 217.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality