Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == * direction: ** left-to-right * common-name: ** γ-glutamyltransferase *...")
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] ==
+
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** γ-glutamyltransferase
+
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.2.2 ec-2.3.2.2]
+
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Amino-Acids-20]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c] '''+''' 1 [[CYS-GLY]][c]
+
** rqmcndrmpzbeod-uhfffaoysa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ08599]]
+
** 217.112
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-2464]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-2464]]
−
* Gene: [[SJ08598]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=217.112}}
−
* [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041]
 
−
** '''5''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=γ-glutamyltransferase}}
 
−
{{#set: ec-number=ec-2.3.2.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE

  • common-name:
    • 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
  • smiles:
    • c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
  • inchi-key:
    • rqmcndrmpzbeod-uhfffaoysa-k
  • molecular-weight:
    • 217.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-OH-4-ACETYL-2-OXOGLUTARATE&oldid=139255"