Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite DGTP ==
+
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
 
* common-name:
 
* common-name:
−
** dgtp
+
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
 
* smiles:
 
* smiles:
−
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** haazlughyhwqiw-kvqbguixsa-j
+
** rqmcndrmpzbeod-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
−
** 503.152
+
** 217.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[DGTCY]]
+
* [[RXN-2464]]
−
* [[DGTD]]
 
−
* [[DGTPTRIPHYDRO-RXN]]
 
−
* [[DGTPtm]]
 
−
* [[DGTUP]]
 
−
* [[RXN-14208]]
 
−
* [[RXN-14217]]
 
−
* [[RXN0-385]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ATDGD]]
+
* [[RXN-2464]]
−
* [[DGDPKIN-RXN]]
 
−
* [[DGTPtm]]
 
−
* [[RXN-14207]]
 
−
* [[RXN0-746]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=dgtp}}
+
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
−
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
+
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
−
{{#set: molecular-weight=503.152}}
+
{{#set: molecular-weight=217.112}}

Latest revision as of 11:16, 18 March 2021

Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE

  • common-name:
    • 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
  • smiles:
    • c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
  • inchi-key:
    • rqmcndrmpzbeod-uhfffaoysa-k
  • molecular-weight:
    • 217.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-OH-4-ACETYL-2-OXOGLUTARATE&oldid=139255"