Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] == * direction: ** reversible * common-name: ** s-adenosyl-l-methionine reversible...")
 
(Created page with "Category:metabolite == Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE == * common-name: ** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate * smiles: ** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] ==
+
== Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** s-adenosyl-l-methionine reversible transport, mitochondrial
+
** 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][m] '''<=>''' 1.0 [[ADENOSYL-HOMO-CYS]][m] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][c]
+
** c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ00013]]
+
** rqmcndrmpzbeod-uhfffaoysa-k
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 217.112
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN-2464]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[RXN-2464]]
−
{{#set: direction=reversible}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=s-adenosyl-l-methionine reversible transport, mitochondrial}}
+
{{#set: common-name=2-hydroxy-4-oxobutane-1,2,4-tricarboxylate}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=rqmcndrmpzbeod-uhfffaoysa-k}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=217.112}}
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite 4-OH-4-ACETYL-2-OXOGLUTARATE

  • common-name:
    • 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
  • smiles:
    • c(c(cc(o)(cc(=o)[o-])c(=o)[o-])=o)(=o)[o-]
  • inchi-key:
    • rqmcndrmpzbeod-uhfffaoysa-k
  • molecular-weight:
    • 217.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-OH-4-ACETYL-2-OXOGLUTARATE&oldid=139255"