Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-CYCLODEAMINASE-RXN ORNITHINE-CYCLODEAMINASE-RXN] == * direction: ** left-to-right * commo...")
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE-CYCLODEAMINASE-RXN ORNITHINE-CYCLODEAMINASE-RXN] ==
+
== Metabolite DGTP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** ornithine cyclodeaminase
+
** dgtp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.3.1.12 ec-4.3.1.12]
+
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[L-ORNITHINE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PRO]][c]
+
** haazlughyhwqiw-kvqbguixsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10037]]
+
** 503.152
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DGTCY]]
−
** Category: [[orthology]]
+
* [[DGTD]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DGTPTRIPHYDRO-RXN]]
−
== Pathway(s) ==
+
* [[DGTPtm]]
−
* [[ARG-GLU-PWY]], L-arginine degradation VII (arginase 3 pathway): [http://metacyc.org/META/NEW-IMAGE?object=ARG-GLU-PWY ARG-GLU-PWY]
+
* [[DGTUP]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-14208]]
−
* [[ORN-AMINOPENTANOATE-CAT-PWY]], L-ornithine degradation I (L-proline biosynthesis): [http://metacyc.org/META/NEW-IMAGE?object=ORN-AMINOPENTANOATE-CAT-PWY ORN-AMINOPENTANOATE-CAT-PWY]
+
* [[RXN-14217]]
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[RXN0-385]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[ATDGD]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DGDPKIN-RXN]]
−
== External links  ==
+
* [[DGTPtm]]
−
* RHEA:
+
* [[RXN-14207]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24369 24369]
+
* [[RXN0-746]]
−
* LIGAND-RXN:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.genome.jp/dbget-bin/www_bget?R00671 R00671]
+
{{#set: common-name=dgtp}}
−
* UNIPROT:
+
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
−
** [http://www.uniprot.org/uniprot/Q59701 Q59701]
+
{{#set: molecular-weight=503.152}}
−
** [http://www.uniprot.org/uniprot/P09773 P09773]
 
−
** [http://www.uniprot.org/uniprot/P33728 P33728]
 
−
** [http://www.uniprot.org/uniprot/O68052 O68052]
 
−
** [http://www.uniprot.org/uniprot/Q9WWA2 Q9WWA2]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=ornithine cyclodeaminase}}
 
−
{{#set: ec-number=ec-4.3.1.12}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite DGTP

  • common-name:
    • dgtp
  • smiles:
    • c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • haazlughyhwqiw-kvqbguixsa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-OH-4-ACETYL-2-OXOGLUTARATE&oldid=48071"