Difference between revisions of "4-OH-4-ACETYL-2-OXOGLUTARATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGTP == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-...") |
(Created page with "Category:metabolite == Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs == * common-name: ** a cis-delta21-39-oxo-40-methyl-c59:1-[acp] == Reaction(s) known to consume the compo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cis-delta21-39-oxo-40-methyl-c59:1-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-3641]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cis-delta21-39-oxo-40-methyl-c59:1-[acp]}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs
- common-name:
- a cis-delta21-39-oxo-40-methyl-c59:1-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a cis-delta21-39-oxo-40-methyl-c59:1-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
