Difference between revisions of "4-P-PANTOTHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * common-name: ** (r)-4'-phosphopantothenate * smiles: ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c * inchi-key:...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-P-PANTOTHENATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (r)-4'-phosphopantothenate |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xhfvghpgdldeqo-zetcqymhsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 296.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[P-PANTOCYSLIG-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[PANTOTHENATE-KIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(r)-4'-phosphopantothenate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xhfvghpgdldeqo-zetcqymhsa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=296.193}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 4-P-PANTOTHENATE
- common-name:
- (r)-4'-phosphopantothenate
- smiles:
- cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c
- inchi-key:
- xhfvghpgdldeqo-zetcqymhsa-k
- molecular-weight:
- 296.193