Difference between revisions of "4-PRENYLPHLORISOBUTYROPHENONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12431 == * transcription-direction: ** negative * right-end-position: ** 323433 * left-end-position: ** 304855 * centisome-position: ** 85.16407...")
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12431 ==
+
== Metabolite 1-7-DIMETHYLXANTHINE ==
* transcription-direction:
+
* common-name:
** negative
+
** paraxanthine
* right-end-position:
+
* smiles:
** 323433
+
** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
* left-end-position:
+
* inchi-key:
** 304855
+
** qunwudvfrngtco-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 85.16407   
+
** 180.166
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11520]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN-5286]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=paraxanthine}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}}
** Category: [[orthology]]
+
{{#set: molecular-weight=180.166}}
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN1F-72]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5086]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-7760]]
 
** '''1''' reactions found over '''30''' reactions in the full pathway
 
* [[PWY-7758]]
 
** '''1''' reactions found over '''14''' reactions in the full pathway
 
* [[PWY-7759]]
 
** '''1''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-5064]]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-5526]]
 
** '''5''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=323433}}
 
{{#set: left-end-position=304855}}
 
{{#set: centisome-position=85.16407    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=6}}
 

Revision as of 20:30, 18 December 2020

Metabolite 1-7-DIMETHYLXANTHINE

  • common-name:
    • paraxanthine
  • smiles:
    • cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
  • inchi-key:
    • qunwudvfrngtco-uhfffaoysa-n
  • molecular-weight:
    • 180.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality