Difference between revisions of "4-TOLUENECARBOXYLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDOSE1EPIM-RXN ALDOSE1EPIM-RXN] == * direction: ** reversible * common-name: ** galactose-1-epimer...")
 
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDOSE1EPIM-RXN ALDOSE1EPIM-RXN] ==
+
== Metabolite 4-TOLUENECARBOXYLATE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** galactose-1-epimerase
+
** 4-toluenecarboxylate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.1.3.3 ec-5.1.3.3]
+
** cc1(c=cc(=cc=1)c(=o)[o-])
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GALACTOSE]][c] '''<=>''' 1 [[ALPHA-D-GALACTOSE]][c]
+
** lpnbbfkouusudb-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17177]]
+
** 135.142
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-8582]]
−
* [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317]
+
== Reaction(s) of unknown directionality ==
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=4-toluenecarboxylate}}
−
* [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422]
+
{{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}}
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=135.142}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28678 28678]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=galactose-1-epimerase}}
 
−
{{#set: ec-number=ec-5.1.3.3}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 4-TOLUENECARBOXYLATE

  • common-name:
    • 4-toluenecarboxylate
  • smiles:
    • cc1(c=cc(=cc=1)c(=o)[o-])
  • inchi-key:
    • lpnbbfkouusudb-uhfffaoysa-m
  • molecular-weight:
    • 135.142

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=4-TOLUENECARBOXYLATE&oldid=139705"