Difference between revisions of "4-TRIMETHYLAMMONIOBUTANAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...") |
(Created page with "Category:metabolite == Metabolite 4-TRIMETHYLAMMONIOBUTANAL == * common-name: ** 4-trimethylammoniobutanal * smiles: ** c(cc[ch]=o)[n+](c)(c)c * inchi-key: ** oitblcdwxsxn...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-TRIMETHYLAMMONIOBUTANAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-trimethylammoniobutanal |
* smiles: | * smiles: | ||
| − | ** cc | + | ** c(cc[ch]=o)[n+](c)(c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oitblcdwxsxncn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 130.209 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9896]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-trimethylammoniobutanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oitblcdwxsxncn-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=130.209}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 4-TRIMETHYLAMMONIOBUTANAL
- common-name:
- 4-trimethylammoniobutanal
- smiles:
- c(cc[ch]=o)[n+](c)(c)c
- inchi-key:
- oitblcdwxsxncn-uhfffaoysa-n
- molecular-weight:
- 130.209
