Difference between revisions of "4-TRIMETHYLAMMONIOBUTANAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Oxo-Delta-4-Steroids == * common-name: ** a 3-oxo-δ4-steroid == Reaction(s) known to consume the compound == * 1.3.99.5-RXN *...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-GLUTAMYL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetylglutamyl-phosphate |
| + | * smiles: | ||
| + | ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** fcvihfvsxhopsw-yfkpbyrvsa-k | ||
| + | * molecular-weight: | ||
| + | ** 266.124 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACETYLGLUTKIN-RXN]] |
| − | * [[RXN | + | * [[N-ACETYLGLUTPREDUCT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ACETYLGLUTKIN-RXN]] |
| + | * [[AGK]] | ||
| + | * [[N-ACETYLGLUTPREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetylglutamyl-phosphate}} |
| + | {{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}} | ||
| + | {{#set: molecular-weight=266.124}} | ||
Revision as of 13:11, 14 January 2021
Contents
Metabolite N-ACETYL-GLUTAMYL-P
- common-name:
- n-acetylglutamyl-phosphate
- smiles:
- cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
- inchi-key:
- fcvihfvsxhopsw-yfkpbyrvsa-k
- molecular-weight:
- 266.124
