Difference between revisions of "5-10-METHENYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE == * common-name: ** n7-methylguanosine 5'-phosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12902 ==
+
== Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE ==
 
* common-name:
 
* common-name:
** 5-methylhex-4-enoyl-coa
+
** n7-methylguanosine 5'-phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
 
* inchi-key:
 
* inchi-key:
** beyylhumfmwplh-svhodsnwsa-j
+
** aokqnzvjjxpuqa-kqynxxcusa-m
 
* molecular-weight:
 
* molecular-weight:
** 873.658
+
** 376.242
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
+
* [[RXN-12826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=n7-methylguanosine 5'-phosphate}}
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+
{{#set: inchi-key=inchikey=aokqnzvjjxpuqa-kqynxxcusa-m}}
{{#set: molecular-weight=873.658}}
+
{{#set: molecular-weight=376.242}}

Revision as of 18:58, 14 January 2021

Metabolite 7-METHYLGUANOSINE-5-PHOSPHATE

  • common-name:
    • n7-methylguanosine 5'-phosphate
  • smiles:
    • c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])[o-])c(o)c(o)3))
  • inchi-key:
    • aokqnzvjjxpuqa-kqynxxcusa-m
  • molecular-weight:
    • 376.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality