Difference between revisions of "5-10-METHENYL-THF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite 5-10-METHENYL-THF == * common-name: ** 5,10-methenyltetrahydrofolate mono-l-glutamate * smiles: ** c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12902 ==
+
== Metabolite 5-10-METHENYL-THF ==
 
* common-name:
 
* common-name:
** 5-methylhex-4-enoyl-coa
+
** 5,10-methenyltetrahydrofolate mono-l-glutamate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
 
* inchi-key:
 
* inchi-key:
** beyylhumfmwplh-svhodsnwsa-j
+
** meanfmoqmxymct-olzocxbdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 873.658
+
** 454.421
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[METHFth]]
 +
* [[MTHFD2]]
 +
* [[MTHFD2i]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
+
* [[FGFTh]]
 +
* [[METHFth]]
 +
* [[MTHFCx]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=5,10-methenyltetrahydrofolate mono-l-glutamate}}
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+
{{#set: inchi-key=inchikey=meanfmoqmxymct-olzocxbdsa-m}}
{{#set: molecular-weight=873.658}}
+
{{#set: molecular-weight=454.421}}

Latest revision as of 11:17, 18 March 2021

Metabolite 5-10-METHENYL-THF

  • common-name:
    • 5,10-methenyltetrahydrofolate mono-l-glutamate
  • smiles:
    • c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
  • inchi-key:
    • meanfmoqmxymct-olzocxbdsa-m
  • molecular-weight:
    • 454.421

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality