|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE--TRNA-LIGASE-RXN GLYCINE--TRNA-LIGASE-RXN] == | + | == Metabolite CPD-7417 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** glycine-trna ligase | + | ** cis-coumarinic acid-β-d-glucoside |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.14 ec-6.1.1.14] | + | ** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[GLY-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-GLY-tRNAs]][c] '''+''' 1 [[PPI]][c]
| + | ** gvriyimnjgulcz-qlfwqtqqsa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ16976]] | + | ** 325.294 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-8036]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ04580]]
| + | {{#set: common-name=cis-coumarinic acid-β-d-glucoside}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=325.294}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ16484]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16014 16014]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03654 R03654]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P41250 P41250]
| |
| − | ** [http://www.uniprot.org/uniprot/P54380 P54380]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZCB1 Q9ZCB1]
| |
| − | ** [http://www.uniprot.org/uniprot/P43822 P43822]
| |
| − | ** [http://www.uniprot.org/uniprot/P54381 P54381]
| |
| − | ** [http://www.uniprot.org/uniprot/O51344 O51344]
| |
| − | ** [http://www.uniprot.org/uniprot/Q46371 Q46371]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZCB0 Q9ZCB0]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9WY59 Q9WY59]
| |
| − | ** [http://www.uniprot.org/uniprot/P43821 P43821]
| |
| − | ** [http://www.uniprot.org/uniprot/O83678 O83678]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9WY60 Q9WY60]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPK3 Q9PPK3]
| |
| − | ** [http://www.uniprot.org/uniprot/P56454 P56454]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PN63 Q9PN63]
| |
| − | ** [http://www.uniprot.org/uniprot/Q57681 Q57681]
| |
| − | ** [http://www.uniprot.org/uniprot/P67029 P67029]
| |
| − | ** [http://www.uniprot.org/uniprot/O67081 O67081]
| |
| − | ** [http://www.uniprot.org/uniprot/O67898 O67898]
| |
| − | ** [http://www.uniprot.org/uniprot/O59235 O59235]
| |
| − | ** [http://www.uniprot.org/uniprot/P47493 P47493]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZKP1 Q9ZKP1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JW67 Q9JW67]
| |
| − | ** [http://www.uniprot.org/uniprot/P56453 P56453]
| |
| − | ** [http://www.uniprot.org/uniprot/O27874 O27874]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZKM9 Q9ZKM9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CGK0 Q9CGK0]
| |
| − | ** [http://www.uniprot.org/uniprot/P38088 P38088]
| |
| − | ** [http://www.uniprot.org/uniprot/Q06817 Q06817]
| |
| − | ** [http://www.uniprot.org/uniprot/Q51114 Q51114]
| |
| − | ** [http://www.uniprot.org/uniprot/P75425 P75425]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55716 Q55716]
| |
| − | ** [http://www.uniprot.org/uniprot/P00960 P00960]
| |
| − | ** [http://www.uniprot.org/uniprot/P00961 P00961]
| |
| − | ** [http://www.uniprot.org/uniprot/Q8L785 Q8L785]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=glycine-trna ligase}} | |
| − | {{#set: ec-number=ec-6.1.1.14}}
| |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
