Difference between revisions of "5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9903 == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
(Created page with "Category:metabolite == Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL == * common-name: ** 5α-cholesta-7,24-dien-3β-ol * smiles: ** cc(c)=cccc(c)[ch]1(cc[ch]3(c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9903 ==
+
== Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+
** 5α-cholesta-7,24-dien-3β-ol
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
+
** cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)([ch](cc=c23)cc(o)cc4))))
 
* inchi-key:
 
* inchi-key:
** lieylsgxgoxytd-ctbyciiysa-m
+
** pkeppdggtszlbl-skcnuyalsa-n
 
* molecular-weight:
 
* molecular-weight:
** 629.941
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9287]]
+
* [[RXN-11887]]
 +
* [[RXN66-321]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-320]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=5α-cholesta-7,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
+
{{#set: inchi-key=inchikey=pkeppdggtszlbl-skcnuyalsa-n}}
{{#set: molecular-weight=629.941}}
+
{{#set: molecular-weight=384.644}}

Latest revision as of 11:15, 18 March 2021

Metabolite 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL

  • common-name:
    • 5α-cholesta-7,24-dien-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]1(cc[ch]3(c(c)1cc[ch]2(c4(c)([ch](cc=c23)cc(o)cc4))))
  • inchi-key:
    • pkeppdggtszlbl-skcnuyalsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality