Difference between revisions of "5-AMINO-LEVULINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...") |
(Created page with "Category:metabolite == Metabolite 5-AMINO-LEVULINATE == * common-name: ** 5-aminolevulinate * smiles: ** c(c(c[n+])=o)cc([o-])=o * inchi-key: ** zgxjtsgniosylo-uhfffaoysa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-AMINO-LEVULINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-aminolevulinate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c(c[n+])=o)cc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zgxjtsgniosylo-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 131.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PORPHOBILSYNTH-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[GSAAMINOTRANS-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-aminolevulinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zgxjtsgniosylo-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=131.131}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 5-AMINO-LEVULINATE
- common-name:
- 5-aminolevulinate
- smiles:
- c(c(c[n+])=o)cc([o-])=o
- inchi-key:
- zgxjtsgniosylo-uhfffaoysa-n
- molecular-weight:
- 131.131
