Difference between revisions of "5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...")
(Created page with "Category:metabolite == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == * common-name: ** udp-β-l-threo-pentapyranos-4-ulose * smiles: ** c3(oc(op(=o)([o-])op(=o)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11665 ==
+
== Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- ==
 
* common-name:
 
* common-name:
−
** serotonin o-sulfate
+
** udp-β-l-threo-pentapyranos-4-ulose
 
* smiles:
 
* smiles:
−
** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
+
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
 
* inchi-key:
 
* inchi-key:
−
** jfwysggscoobgk-uhfffaoysa-n
+
** urjziqltpcjvmw-qnsckltrsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 256.276
+
** 532.247
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-1863]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10777]]
+
* [[RXN0-1863]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=serotonin o-sulfate}}
+
{{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}}
−
{{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}}
−
{{#set: molecular-weight=256.276}}
+
{{#set: molecular-weight=532.247}}

Latest revision as of 11:13, 18 March 2021

Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-

  • common-name:
    • udp-β-l-threo-pentapyranos-4-ulose
  • smiles:
    • c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
  • inchi-key:
    • urjziqltpcjvmw-qnsckltrsa-l
  • molecular-weight:
    • 532.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-&oldid=137507"