Difference between revisions of "5-CarboxyMeAmMe-2-O-MeU34-tRNALeu"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...")
(Created page with "Category:metabolite == Metabolite CPD1G-773 == * common-name: ** 6-o-cis-keto-mycolyl-trehalose 6-phosphate * smiles: ** ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-6-P ==
+
== Metabolite CPD1G-773 ==
 
* common-name:
 
* common-name:
** β-d-glucose 6-phosphate
+
** 6-o-cis-keto-mycolyl-trehalose 6-phosphate
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
+
** ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))=o)c(o)cccccccccccccccccccc3(cc(ccccccccccccccccc(=o)c(cccccccccccccccccc)c)3)
 
* inchi-key:
 
* inchi-key:
** nbschqhzlsjfnq-vfuothlcsa-l
+
** zltumijwnaqhqs-wbsumzshsa-l
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 1668.519
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[G6PBDH]]
+
* [[RXN1G-1438]]
* [[G6PBDHh]]
 
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[RXN66-579]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-glucose 6-phosphate}}
+
{{#set: common-name=6-o-cis-keto-mycolyl-trehalose 6-phosphate}}
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}}
+
{{#set: inchi-key=inchikey=zltumijwnaqhqs-wbsumzshsa-l}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=1668.519}}

Revision as of 11:17, 15 January 2021

Metabolite CPD1G-773

  • common-name:
    • 6-o-cis-keto-mycolyl-trehalose 6-phosphate
  • smiles:
    • ccccccccccccccccccccccccc(c(occ1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))=o)c(o)cccccccccccccccccccc3(cc(ccccccccccccccccc(=o)c(cccccccccccccccccc)c)3)
  • inchi-key:
    • zltumijwnaqhqs-wbsumzshsa-l
  • molecular-weight:
    • 1668.519

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality