Difference between revisions of "5-CarboxyMeAmMe-2-O-MeU34-tRNALeu"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
(Created page with "Category:metabolite == Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu == * common-name: ** a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu == Reaction(s) known...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11865]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-CarboxyMeAmMe-2-O-MeU34-tRNALeu
- common-name:
- a 5-carboxymethylaminomethyl-2'-o-methyluridine34 in trnaleu
